| Primary information |
|---|
| PRRID | PRRID_1549 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | triggers immune responses |
| Name of receptor | PGN-binding proteins (PGRPs) |
| Type of receptor | Peptidoglycan Recognition Receptor (PGRPs) |
| Source | Mice |
| Localization | lymphocytes, macrophages, dendritic cells |
| Domain | intracellular receptors |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | triggering of these receptors induces activation of the NF-κB pathway and consequently, an immune response |
| Assay used | NA |
| PMID | 24779390 |
| Year of Publication | 2014 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_1549 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | triggers immune responses |
| Name of receptor | PGN-binding proteins (PGRPs) |
| Type of receptor | Peptidoglycan Recognition Receptor (PGRPs) |
| Source | Mice |
| Localization | lymphocytes, macrophages, dendritic cells |
| Domain | intracellular receptors |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | triggering of these receptors induces activation of the NF-κB pathway and consequently, an immune response |
| Assay used | NA |
| PMID | 24779390 |
| Year of Publication | 2014 |
| Pubchem assay | NA |