| Primary information |
|---|
| PRRID | PRRID_1547 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 2 (Nod2) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | peripheral blood mononuclear cells such as macrophages, granulocytes, dendritic cells, and along the intestinal epithelial cells |
| Domain | intracellular receptors |
| Sequence of Receptor | Q9HC29.fasta |
| Swiss prot ID | Q9HC29 |
| Length Of Receptor | 1040 |
| Function | recognizes fragments of the bacterial cell wall. |
| Assay used | Luciferase assay |
| PMID | 24790089 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1547 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 2 (Nod2) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | peripheral blood mononuclear cells such as macrophages, granulocytes, dendritic cells, and along the intestinal epithelial cells |
| Domain | intracellular receptors |
| Sequence of Receptor | Q9HC29.fasta |
| Swiss prot ID | Q9HC29 |
| Length Of Receptor | 1040 |
| Function | recognizes fragments of the bacterial cell wall. |
| Assay used | Luciferase assay |
| PMID | 24790089 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |