| Primary information |
|---|
| PRRID | PRRID_1537 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Gram-positive bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | PGN is known to be a potent activator of NF-κB and TNF-α through TLR2 |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 2 (Nod2) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | lymphocytes, macrophages, dendritic cells and also in nonimmune cells, for example in epithelium |
| Domain | Intracellular receptors |
| Sequence of Receptor | Q9HC29.fasta |
| Swiss prot ID | Q9HC29 |
| Length Of Receptor | 1040 |
| Function | play key roles in regulation of innate immune response. NLRs can cooperate with Toll-like receptors and regulate inflammatory and apoptotic response. |
| Assay used | NA |
| PMID | 24829146 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1537 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Gram-positive bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | PGN is known to be a potent activator of NF-κB and TNF-α through TLR2 |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 2 (Nod2) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | lymphocytes, macrophages, dendritic cells and also in nonimmune cells, for example in epithelium |
| Domain | Intracellular receptors |
| Sequence of Receptor | Q9HC29.fasta |
| Swiss prot ID | Q9HC29 |
| Length Of Receptor | 1040 |
| Function | play key roles in regulation of innate immune response. NLRs can cooperate with Toll-like receptors and regulate inflammatory and apoptotic response. |
| Assay used | NA |
| PMID | 24829146 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |