| Primary information |
|---|
| PRRID | PRRID_1497 |
| Ligand Name | N-glycolylated muramic acid |
| Source | Mycobacterium smegmatis and Mycobacterium tuberculosis (Bacteria) |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)NC(=O)C |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | activates NOD2 |
| Name of receptor | Nod-like receptor 1 (NLR1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice |
| Localization | immune cells like peripheral blood monocytes, granulocytes and dendritic cells, as well as in astrocytes of the brain and in paneth cells of the gut |
| Domain | intracellular receptors |
| Sequence of Receptor | Q8K3Z0.fasta |
| Swiss prot ID | Q8K3Z0 |
| Length Of Receptor | 1020 |
| Function | Nod2, are associ- ated with inflammatory bowel disease in humans |
| Assay used | NA |
| PMID | 24779390 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1497 |
| Ligand Name | N-glycolylated muramic acid |
| Source | Mycobacterium smegmatis and Mycobacterium tuberculosis (Bacteria) |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)NC(=O)C |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | activates NOD2 |
| Name of receptor | Nod-like receptor 1 (NLR1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice |
| Localization | immune cells like peripheral blood monocytes, granulocytes and dendritic cells, as well as in astrocytes of the brain and in paneth cells of the gut |
| Domain | intracellular receptors |
| Sequence of Receptor | Q8K3Z0.fasta |
| Swiss prot ID | Q8K3Z0 |
| Length Of Receptor | 1020 |
| Function | Nod2, are associ- ated with inflammatory bowel disease in humans |
| Assay used | NA |
| PMID | 24779390 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |