| Primary information |
|---|
| PRRID | PRRID_1493 |
| Ligand Name | muramyl dipeptide (MDP) |
| Source | Gram-negative and Gram-positive bacteria |
| Sequence of ligand | CC(C(=O)NC(CCC(=O)O)C(=O)N)NC(=O)C(C)OC1C(C(OC(C1O)CO)O)NC(=O)C |
| Length | NA |
| Type | Peptide |
| Occurence | Natural |
| Role of Ligand | induces interleu- kin-8 (IL-8) production, CD62 ligand shedding, and CD11b up-regulation |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 2 (Nod2) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice |
| Localization | Neutrophils |
| Domain | serine/threonine RIP2 (RICK, CARDIAK) kinase |
| Sequence of Receptor | Q8K3Z0.fasta |
| Swiss prot ID | Q8K3Z0 |
| Length Of Receptor | 1020 |
| Function | involved in neutrophil immune responses in response to bacterial infection. |
| Assay used | ELISA |
| PMID | 24766550 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1493 |
| Ligand Name | muramyl dipeptide (MDP) |
| Source | Gram-negative and Gram-positive bacteria |
| Sequence of ligand | CC(C(=O)NC(CCC(=O)O)C(=O)N)NC(=O)C(C)OC1C(C(OC(C1O)CO)O)NC(=O)C |
| Length | NA |
| Type | Peptide |
| Occurence | Natural |
| Role of Ligand | induces interleu- kin-8 (IL-8) production, CD62 ligand shedding, and CD11b up-regulation |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 2 (Nod2) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice |
| Localization | Neutrophils |
| Domain | serine/threonine RIP2 (RICK, CARDIAK) kinase |
| Sequence of Receptor | Q8K3Z0.fasta |
| Swiss prot ID | Q8K3Z0 |
| Length Of Receptor | 1020 |
| Function | involved in neutrophil immune responses in response to bacterial infection. |
| Assay used | ELISA |
| PMID | 24766550 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |