| Primary information |
|---|
| PRRID | PRRID_1483 |
| Ligand Name | meso-diaminopomelic acid (meso- DAP) |
| Source | Gram-negative bacteria and several Gram-positive bacteria such as Listeria and Bacillus spp |
| Sequence of ligand | C(CC(C(=O)O)N)CC(C(=O)O)N |
| Length | NA |
| Type | Peptide |
| Occurence | Natural |
| Role of Ligand | in vitro activates Nod1 |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | macrophages and mesothelial cells |
| Domain | serine/threonine RIP2 (RICK, CARDIAK) kinase |
| Sequence of Receptor | Q9Y239.fasta |
| Swiss prot ID | Q9Y239 |
| Length Of Receptor | 953 |
| Function | Nod1 ligation also leads to the activation of NF-jB and MAPKs in neutrophils |
| Assay used | ELISA |
| PMID | 24766550 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1483 |
| Ligand Name | meso-diaminopomelic acid (meso- DAP) |
| Source | Gram-negative bacteria and several Gram-positive bacteria such as Listeria and Bacillus spp |
| Sequence of ligand | C(CC(C(=O)O)N)CC(C(=O)O)N |
| Length | NA |
| Type | Peptide |
| Occurence | Natural |
| Role of Ligand | in vitro activates Nod1 |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | macrophages and mesothelial cells |
| Domain | serine/threonine RIP2 (RICK, CARDIAK) kinase |
| Sequence of Receptor | Q9Y239.fasta |
| Swiss prot ID | Q9Y239 |
| Length Of Receptor | 953 |
| Function | Nod1 ligation also leads to the activation of NF-jB and MAPKs in neutrophils |
| Assay used | ELISA |
| PMID | 24766550 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |