| Primary information |
|---|
| PRRID | PRRID_1478 |
| Ligand Name | MALP-2 (macrophage-activating lipopeptide 2) |
| Source | Mycoplasma (Bacteria) |
| Sequence of ligand | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)NC(=O)CCC(C(=O)O)N |
| Length | NA |
| Type | Lipopeptides |
| Occurence | Natural |
| Role of Ligand | It primes macrophages for cytokines secretion |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | C57BL/6J mice |
| Localization | monocyte/macrophages, Myeloid DCs, neutrophils, Mast cells |
| Domain | Toll/IL-1R (TIR) domain-containing adaptor molecule MyD88 (myeloid differentiation factor 88)-dependent pathway |
| Sequence of Receptor | Q9QUN7.fasta |
| Swiss prot ID | Q9QUN7 |
| Length Of Receptor | 784 |
| Function | significant role in the pathogenesis of severe inflammatory responses |
| Assay used | ELISA |
| PMID | 24712905 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1478 |
| Ligand Name | MALP-2 (macrophage-activating lipopeptide 2) |
| Source | Mycoplasma (Bacteria) |
| Sequence of ligand | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)NC(=O)CCC(C(=O)O)N |
| Length | NA |
| Type | Lipopeptides |
| Occurence | Natural |
| Role of Ligand | It primes macrophages for cytokines secretion |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | C57BL/6J mice |
| Localization | monocyte/macrophages, Myeloid DCs, neutrophils, Mast cells |
| Domain | Toll/IL-1R (TIR) domain-containing adaptor molecule MyD88 (myeloid differentiation factor 88)-dependent pathway |
| Sequence of Receptor | Q9QUN7.fasta |
| Swiss prot ID | Q9QUN7 |
| Length Of Receptor | 784 |
| Function | significant role in the pathogenesis of severe inflammatory responses |
| Assay used | ELISA |
| PMID | 24712905 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |