| Primary information |
|---|
| PRRID | PRRID_1476 |
| Ligand Name | MALP-2 (macrophage-activating lipopeptide 2) |
| Source | Mycoplasma (Bacteria) |
| Sequence of ligand | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)NC(=O)CCC(C(=O)O)N |
| Length | NA |
| Type | Lipopeptides |
| Occurence | Natural |
| Role of Ligand | It primes macrophages for cytokines secretion |
| Name of receptor | Toll-like receptor 2 (TLR2)/Toll-like receptor 6 (TLR6) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | monocyte/macrophages |
| Domain | cell surface |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | fundamental role in pathogen recognition and activation of innate immunity. |
| Assay used | ELISA |
| PMID | 24771854 |
| Year of Publication | 2014 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_1476 |
| Ligand Name | MALP-2 (macrophage-activating lipopeptide 2) |
| Source | Mycoplasma (Bacteria) |
| Sequence of ligand | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)NC(=O)CCC(C(=O)O)N |
| Length | NA |
| Type | Lipopeptides |
| Occurence | Natural |
| Role of Ligand | It primes macrophages for cytokines secretion |
| Name of receptor | Toll-like receptor 2 (TLR2)/Toll-like receptor 6 (TLR6) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | monocyte/macrophages |
| Domain | cell surface |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | fundamental role in pathogen recognition and activation of innate immunity. |
| Assay used | ELISA |
| PMID | 24771854 |
| Year of Publication | 2014 |
| Pubchem assay | NA |