| Primary information |
|---|
| PRRID | PRRID_1461 |
| Ligand Name | Loxoribine (7-allyl-7,8-dihydro-8-oxo-guanosine) |
| Source | Guanosine (others) |
| Sequence of ligand | C=CCN1C2=C(NC(=NC2=O)N)N(C1=O)C3C(C(C(O3)CO)O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | It activates the innate immune system through Toll-like receptor 7 |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Guinea Pig |
| Localization | plasmacytoid and myeloid DCs |
| Domain | Cell Compartment/Intracellular (Endosome) |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | important role in the immune response to viral infection |
| Assay used | Real-time RT-PCR, Calcium influx assay |
| PMID | 24819048 |
| Year of Publication | 2014 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_1461 |
| Ligand Name | Loxoribine (7-allyl-7,8-dihydro-8-oxo-guanosine) |
| Source | Guanosine (others) |
| Sequence of ligand | C=CCN1C2=C(NC(=NC2=O)N)N(C1=O)C3C(C(C(O3)CO)O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | It activates the innate immune system through Toll-like receptor 7 |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Guinea Pig |
| Localization | plasmacytoid and myeloid DCs |
| Domain | Cell Compartment/Intracellular (Endosome) |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | important role in the immune response to viral infection |
| Assay used | Real-time RT-PCR, Calcium influx assay |
| PMID | 24819048 |
| Year of Publication | 2014 |
| Pubchem assay | NA |