| Primary information |
|---|
| PRRID | PRRID_1459 |
| Ligand Name | low molecular weight molecules of the imidazoquinoline family |
| Source | A tricyclic aromatic heterocycle formed by fusion of an imidazole ring with the pyridine ring |
| Sequence of ligand | CCOCC1=NC2=C(N1CC(C)(C)O)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | induce type I IFN, antiviral and antitumor therapeutic molecules |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | plasmacytoid and myeloid DCs |
| Domain | extracellular domain (ECD) |
| Sequence of Receptor | Q9NR97.fasta |
| Swiss prot ID | Q9NR97 |
| Length Of Receptor | 1041 |
| Function | controlling antiviral host defense or autoimmune diseases and TLR8 and respond to its activation with TNF production and/or degranulation |
| Assay used | Microarray analysis, Quantitative PCR, Phosphoproteomic screen, Confocal cell imaging,RNA40 pull-down assay and Immunoblot |
| PMID | 24813206 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1459 |
| Ligand Name | low molecular weight molecules of the imidazoquinoline family |
| Source | A tricyclic aromatic heterocycle formed by fusion of an imidazole ring with the pyridine ring |
| Sequence of ligand | CCOCC1=NC2=C(N1CC(C)(C)O)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | induce type I IFN, antiviral and antitumor therapeutic molecules |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | plasmacytoid and myeloid DCs |
| Domain | extracellular domain (ECD) |
| Sequence of Receptor | Q9NR97.fasta |
| Swiss prot ID | Q9NR97 |
| Length Of Receptor | 1041 |
| Function | controlling antiviral host defense or autoimmune diseases and TLR8 and respond to its activation with TNF production and/or degranulation |
| Assay used | Microarray analysis, Quantitative PCR, Phosphoproteomic screen, Confocal cell imaging,RNA40 pull-down assay and Immunoblot |
| PMID | 24813206 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |