Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_1446 details |
| Primary information | |
|---|---|
| PRRID | PRRID_1446 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | Bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Chicken |
| Localization | splenocytes |
| Domain | cell surface |
| Sequence of Receptor | Q9DD78.fasta |
| Swiss prot ID | Q9DD78 |
| Length Of Receptor | 793 |
| Function | TLR2 and TLR5 promote cellular activation and the production of cytokines including proinflammatory interleukin (IL)-6, as well as those cytokines that help to initiate and modulate the adaptive immune response, including IL-4, IL-12, and interferon (IFN)-c |
| Assay used | ELISA |
| PMID | 24797722 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information | |
|---|---|
| PRRID | PRRID_1446 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | Bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Chicken |
| Localization | splenocytes |
| Domain | cell surface |
| Sequence of Receptor | Q9DD78.fasta |
| Swiss prot ID | Q9DD78 |
| Length Of Receptor | 793 |
| Function | TLR2 and TLR5 promote cellular activation and the production of cytokines including proinflammatory interleukin (IL)-6, as well as those cytokines that help to initiate and modulate the adaptive immune response, including IL-4, IL-12, and interferon (IFN)-c |
| Assay used | ELISA |
| PMID | 24797722 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |