| Primary information |
|---|
| PRRID | PRRID_1377 |
| Ligand Name | Imiquimod (R837) |
| Source | Virus |
| Sequence of ligand | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | immune modulators |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | plasmacytoid and myeloid DCs |
| Domain | Cell Compartment/Intracellular (Endosome) |
| Sequence of Receptor | Q9NYK1.fasta |
| Swiss prot ID | Q9NYK1 |
| Length Of Receptor | 1049 |
| Function | TLR7-mediated activation of these cells resulted in the induction of the pro-inflammatory cytokines IFN-α, IFN-β, TNF-α, and IL-12 |
| Assay used | ELISA |
| PMID | 24825342 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1377 |
| Ligand Name | Imiquimod (R837) |
| Source | Virus |
| Sequence of ligand | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | immune modulators |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | plasmacytoid and myeloid DCs |
| Domain | Cell Compartment/Intracellular (Endosome) |
| Sequence of Receptor | Q9NYK1.fasta |
| Swiss prot ID | Q9NYK1 |
| Length Of Receptor | 1049 |
| Function | TLR7-mediated activation of these cells resulted in the induction of the pro-inflammatory cytokines IFN-α, IFN-β, TNF-α, and IL-12 |
| Assay used | ELISA |
| PMID | 24825342 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |