| Primary information |
|---|
| PRRID | PRRID_1375 |
| Ligand Name | Imiquimod |
| Source | imidazoquinoline amine analogue to guanosine (others) |
| Sequence of ligand | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | induced significant up-regulation of IL-1b, IL-6, IL-8, IL-10, IFN-c, IFN-a1 and Mx |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | monocyte/macrophages, plasmacytoid DCs and B-lymphocytes |
| Domain | NA |
| Sequence of Receptor | Q9NYK1.fasta |
| Swiss prot ID | Q9NYK1 |
| Length Of Receptor | 1049 |
| Function | important role in the immune response to viral infection |
| Assay used | Real-time PCR |
| PMID | 24736205 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1375 |
| Ligand Name | Imiquimod |
| Source | imidazoquinoline amine analogue to guanosine (others) |
| Sequence of ligand | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | induced significant up-regulation of IL-1b, IL-6, IL-8, IL-10, IFN-c, IFN-a1 and Mx |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | monocyte/macrophages, plasmacytoid DCs and B-lymphocytes |
| Domain | NA |
| Sequence of Receptor | Q9NYK1.fasta |
| Swiss prot ID | Q9NYK1 |
| Length Of Receptor | 1049 |
| Function | important role in the immune response to viral infection |
| Assay used | Real-time PCR |
| PMID | 24736205 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |