| Primary information |
|---|
| PRRID | PRRID_1373 |
| Ligand Name | Imiquimod |
| Source | NA |
| Sequence of ligand | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | Amine analog to guanosine, is an immune response modifier with potent indirect antiviral activity. |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Spleen cells |
| Domain | cell compartment |
| Sequence of Receptor | Q9NYK1.fasta |
| Swiss prot ID | Q9NYK1 |
| Length Of Receptor | 1049 |
| Function | important role in the immune response to viral infection |
| Assay used | whole blood assay (WBA), ELISA |
| PMID | 24766820 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1373 |
| Ligand Name | Imiquimod |
| Source | NA |
| Sequence of ligand | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | Amine analog to guanosine, is an immune response modifier with potent indirect antiviral activity. |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Spleen cells |
| Domain | cell compartment |
| Sequence of Receptor | Q9NYK1.fasta |
| Swiss prot ID | Q9NYK1 |
| Length Of Receptor | 1049 |
| Function | important role in the immune response to viral infection |
| Assay used | whole blood assay (WBA), ELISA |
| PMID | 24766820 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |