| Primary information |
|---|
| PRRID | PRRID_1366 |
| Ligand Name | IL-2 and R848 |
| Source | A tricyclic aromatic heterocycle formed by fusion of an imidazole ring with the pyridine ring |
| Sequence of ligand | CCOCC1=NC2=C(N1CC(C)(C)O)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | selectively stimulate human memory B cells, leading to differentiation of IgG-secreting AFC (Antibody forming cells) |
| Name of receptor | Toll-like receptor 7/8 (TLR7/8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | monocyte/macrophages, DCs, mast cells |
| Domain | Cell Compartment/Intracellular (Endosome) |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | selectively stimulate human memory B cells, leading to differentiation of IgG-secreting AFC |
| Assay used | ELISPOT assay, Proliferation assay |
| PMID | 24828435 |
| Year of Publication | 2014 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_1366 |
| Ligand Name | IL-2 and R848 |
| Source | A tricyclic aromatic heterocycle formed by fusion of an imidazole ring with the pyridine ring |
| Sequence of ligand | CCOCC1=NC2=C(N1CC(C)(C)O)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | selectively stimulate human memory B cells, leading to differentiation of IgG-secreting AFC (Antibody forming cells) |
| Name of receptor | Toll-like receptor 7/8 (TLR7/8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | monocyte/macrophages, DCs, mast cells |
| Domain | Cell Compartment/Intracellular (Endosome) |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | selectively stimulate human memory B cells, leading to differentiation of IgG-secreting AFC |
| Assay used | ELISPOT assay, Proliferation assay |
| PMID | 24828435 |
| Year of Publication | 2014 |
| Pubchem assay | NA |