| Primary information |
|---|
| PRRID | PRRID_1364 |
| Ligand Name | iE-DAP (gamma-D-glutamyl-meso diaminopimelic acid) |
| Source | Gram-negative and Gram-positive bacteria |
| Sequence of ligand | N[C@@H](CCC[C@@H](NC(=O)CC[C@@H](N)C(O)=O)C(O)=O)C(O)=O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | activate NF-κB |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | European and African Children |
| Localization | signals via a caspase- activated recruitment domain (CARD) |
| Domain | signals via a caspase- activated recruitment domain (CARD) |
| Sequence of Receptor | Q9Y239.fasta |
| Swiss prot ID | Q9Y239 |
| Length Of Receptor | 953 |
| Function | plays a fundamental role in pathogen recognition and activation of innate immunity |
| Assay used | ELISA |
| PMID | 24743542 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1364 |
| Ligand Name | iE-DAP (gamma-D-glutamyl-meso diaminopimelic acid) |
| Source | Gram-negative and Gram-positive bacteria |
| Sequence of ligand | N[C@@H](CCC[C@@H](NC(=O)CC[C@@H](N)C(O)=O)C(O)=O)C(O)=O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | activate NF-κB |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | European and African Children |
| Localization | signals via a caspase- activated recruitment domain (CARD) |
| Domain | signals via a caspase- activated recruitment domain (CARD) |
| Sequence of Receptor | Q9Y239.fasta |
| Swiss prot ID | Q9Y239 |
| Length Of Receptor | 953 |
| Function | plays a fundamental role in pathogen recognition and activation of innate immunity |
| Assay used | ELISA |
| PMID | 24743542 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |