| Primary information |
|---|
| PRRID | PRRID_1359 |
| Ligand Name | Hyaluronic acid |
| Source | NA |
| Sequence of ligand | CC(=O)NC1CC(C(OC1OC2C(C(C(OC2C(=O)[O-])O)O)O)CO)O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | the activation of TLR4 by hyaluronic acid leads to a different pattern of gene induction |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | monocyte/macrophages, Myeloid DCs, neutrophils, Mast cells |
| Domain | cell surface |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | Possible effect in case of stroke i.e Up-regulation of TLR2 mRNA correlates with severity of ischemia |
| Assay used | NA |
| PMID | 24807166 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1359 |
| Ligand Name | Hyaluronic acid |
| Source | NA |
| Sequence of ligand | CC(=O)NC1CC(C(OC1OC2C(C(C(OC2C(=O)[O-])O)O)O)CO)O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | the activation of TLR4 by hyaluronic acid leads to a different pattern of gene induction |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | monocyte/macrophages, Myeloid DCs, neutrophils, Mast cells |
| Domain | cell surface |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | Possible effect in case of stroke i.e Up-regulation of TLR2 mRNA correlates with severity of ischemia |
| Assay used | NA |
| PMID | 24807166 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |