| Primary information |
|---|
| PRRID | PRRID_1231 |
| Ligand Name | dextran sodium sulphate and radiation |
| Source | NA |
| Sequence of ligand | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)O)OS(=O)(=O)O)OS(=O)(=O)O)OS(=O)(=O)O)OS(=O)(=O)O)OS(=O)(=O)O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | control intestinal epithelial homeostasis and provide protection from injury |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | monocyte/macrophages, DCs |
| Domain | cell surface |
| Sequence of Receptor | Q9QUN7.fasta |
| Swiss prot ID | Q9QUN7 |
| Length Of Receptor | 784 |
| Function | NA |
| Assay used | reverse transcription–polymerase chain reaction (RT–PCR), real-time RT–PCR, flow cytometry, immunocytochemistry and Western blot analysis. |
| PMID | 24828022 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1231 |
| Ligand Name | dextran sodium sulphate and radiation |
| Source | NA |
| Sequence of ligand | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)O)OS(=O)(=O)O)OS(=O)(=O)O)OS(=O)(=O)O)OS(=O)(=O)O)OS(=O)(=O)O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | control intestinal epithelial homeostasis and provide protection from injury |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | monocyte/macrophages, DCs |
| Domain | cell surface |
| Sequence of Receptor | Q9QUN7.fasta |
| Swiss prot ID | Q9QUN7 |
| Length Of Receptor | 784 |
| Function | NA |
| Assay used | reverse transcription–polymerase chain reaction (RT–PCR), real-time RT–PCR, flow cytometry, immunocytochemistry and Western blot analysis. |
| PMID | 24828022 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |