| Primary information |
|---|
| PRRID | PRRID_1208 |
| Ligand Name | CL097 |
| Source | imidazoquinoline (others) |
| Sequence of ligand | CCOCC1=NC2=C(N1)C(=NC3=CC=CC=C32)N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It induces the activation of NF-κB |
| Name of receptor | Toll-like receptor 7/8 (TLR7/8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | dendritic cells, macrophages, natural killer cells |
| Domain | cell compartment |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | important role in the immune response to viral infection |
| Assay used | ELISA |
| PMID | 24771328 |
| Year of Publication | 2014 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_1208 |
| Ligand Name | CL097 |
| Source | imidazoquinoline (others) |
| Sequence of ligand | CCOCC1=NC2=C(N1)C(=NC3=CC=CC=C32)N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It induces the activation of NF-κB |
| Name of receptor | Toll-like receptor 7/8 (TLR7/8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | dendritic cells, macrophages, natural killer cells |
| Domain | cell compartment |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | important role in the immune response to viral infection |
| Assay used | ELISA |
| PMID | 24771328 |
| Year of Publication | 2014 |
| Pubchem assay | NA |