| Primary information |
|---|
| PRRID | PRRID_1205 |
| Ligand Name | CL075 |
| Source | Thiazoloquinoline compound (others) |
| Sequence of ligand | CCCC1=NC2=C(S1)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | stimulates TLR8 in human peripheral blood mononuclear cells. It activates NF-κB and triggers preferentially the production of TNF-α and IL-12 |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | lung cancer cells |
| Domain | cell compartment |
| Sequence of Receptor | Q9NR97.fasta |
| Swiss prot ID | Q9NR97 |
| Length Of Receptor | 1041 |
| Function | binding of TLR8 to its ligand stimulated cell proliferation |
| Assay used | MTT assay, Cell Proliferation Assay |
| PMID | 24782650 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1205 |
| Ligand Name | CL075 |
| Source | Thiazoloquinoline compound (others) |
| Sequence of ligand | CCCC1=NC2=C(S1)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | stimulates TLR8 in human peripheral blood mononuclear cells. It activates NF-κB and triggers preferentially the production of TNF-α and IL-12 |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | lung cancer cells |
| Domain | cell compartment |
| Sequence of Receptor | Q9NR97.fasta |
| Swiss prot ID | Q9NR97 |
| Length Of Receptor | 1041 |
| Function | binding of TLR8 to its ligand stimulated cell proliferation |
| Assay used | MTT assay, Cell Proliferation Assay |
| PMID | 24782650 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |