| Primary information |
|---|
| PRRID | PRRID_1180 |
| Ligand Name | amidation of the mesoDAP |
| Source | PGN of Gram-positive bacteria |
| Sequence of ligand | C(CC(C(=O)O)N)CC(C(=O)O)N |
| Length | NA |
| Type | Protein |
| Occurence | Natural |
| Role of Ligand | activates NOD2 but not recognised by NOD2 |
| Name of receptor | Nod-like receptor protein 3 (P2X7R) (NLRP3 (P2X7R) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice |
| Localization | most adult tissues |
| Domain | intracellular receptors |
| Sequence of Receptor | Q8BHB0.fasta |
| Swiss prot ID | Q8BHB0 |
| Length Of Receptor | 953 |
| Function | play key roles in regulation of innate immune response. NLRs can cooperate with Toll-like receptors and regulate inflammatory and apoptotic response. |
| Assay used | NA |
| PMID | 24779390 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1180 |
| Ligand Name | amidation of the mesoDAP |
| Source | PGN of Gram-positive bacteria |
| Sequence of ligand | C(CC(C(=O)O)N)CC(C(=O)O)N |
| Length | NA |
| Type | Protein |
| Occurence | Natural |
| Role of Ligand | activates NOD2 but not recognised by NOD2 |
| Name of receptor | Nod-like receptor protein 3 (P2X7R) (NLRP3 (P2X7R) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice |
| Localization | most adult tissues |
| Domain | intracellular receptors |
| Sequence of Receptor | Q8BHB0.fasta |
| Swiss prot ID | Q8BHB0 |
| Length Of Receptor | 953 |
| Function | play key roles in regulation of innate immune response. NLRs can cooperate with Toll-like receptors and regulate inflammatory and apoptotic response. |
| Assay used | NA |
| PMID | 24779390 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |