| Primary information |
|---|
| PRRID | PRRID_1177 |
| Ligand Name | 6-amino-9-benzyl-2- 106 (2-methoxyethoxy)-9H-purin-8-ol (SM360320) |
| Source | NA |
| Sequence of ligand | NC1=C2C(N(CC3=CC=CC=C3)C(O)=N2)=NC(OCCOC)=N1 |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | stimulates TLR7 |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | pDCs |
| Domain | intracellular receptors |
| Sequence of Receptor | P58681.fasta |
| Swiss prot ID | P58681 |
| Length Of Receptor | 1050 |
| Function | important role in the immune response to viral infection |
| Assay used | flow cytometry analysis, Immunofluorescence, Quantitative polymerase chain reaction (qPCR), enzyme-linked immunosorbent assay (ELISA |
| PMID | 24814238 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1177 |
| Ligand Name | 6-amino-9-benzyl-2- 106 (2-methoxyethoxy)-9H-purin-8-ol (SM360320) |
| Source | NA |
| Sequence of ligand | NC1=C2C(N(CC3=CC=CC=C3)C(O)=N2)=NC(OCCOC)=N1 |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | stimulates TLR7 |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | pDCs |
| Domain | intracellular receptors |
| Sequence of Receptor | P58681.fasta |
| Swiss prot ID | P58681 |
| Length Of Receptor | 1050 |
| Function | important role in the immune response to viral infection |
| Assay used | flow cytometry analysis, Immunofluorescence, Quantitative polymerase chain reaction (qPCR), enzyme-linked immunosorbent assay (ELISA |
| PMID | 24814238 |
| Year of Publication | 2014 |
| Pubchem assay | Pubchem_assay |