| Primary information |
|---|
| PRRID | PRRID_1175 |
| Ligand Name | 1-b-D-arabinofuranosylcytosine (Ara-C) |
| Source | Lipid (PAMPS) (others) |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)O)O |
| Length | NA |
| Type | Fatty acid |
| Occurence | Synthetic |
| Role of Ligand | genotoxic anticancer agent |
| Name of receptor | Toll-like receptor 1/2 (TLR1/2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Em-Myc Mice (a Mouse model for Human Burkitt lymphoma and non-Hodgkin lymphomas) |
| Localization | B-cell lymphoma cell lines |
| Domain | cell surface |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | an alkylating chemotherapeutic agent that induces immunogenic cell death and is commonly used to treat B-cell NHL |
| Assay used | ELISA |
| PMID | 24799523 |
| Year of Publication | 2014 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_1175 |
| Ligand Name | 1-b-D-arabinofuranosylcytosine (Ara-C) |
| Source | Lipid (PAMPS) (others) |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)O)O |
| Length | NA |
| Type | Fatty acid |
| Occurence | Synthetic |
| Role of Ligand | genotoxic anticancer agent |
| Name of receptor | Toll-like receptor 1/2 (TLR1/2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Em-Myc Mice (a Mouse model for Human Burkitt lymphoma and non-Hodgkin lymphomas) |
| Localization | B-cell lymphoma cell lines |
| Domain | cell surface |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | an alkylating chemotherapeutic agent that induces immunogenic cell death and is commonly used to treat B-cell NHL |
| Assay used | ELISA |
| PMID | 24799523 |
| Year of Publication | 2014 |
| Pubchem assay | NA |