| Primary information |
|---|
| PRRID | PRRID_1133 |
| Ligand Name | Resiquimod (R-848) |
| Source | imidazoquinoline (others) |
| Sequence of ligand | CCOCC1=NC2=C(N1CC(C)(C)O)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | immune-response modifier possessing antiviral and antitumor activityand also induces the differentiation of MDSCs into mature myeloid cells |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | monocyte/macrophages, plasmacytoid DCs and B-lymphocytes |
| Domain | Cell Compartment/Intracellular (Endosome) |
| Sequence of Receptor | P58681.fasta |
| Swiss prot ID | P58681 |
| Length Of Receptor | 1050 |
| Function | important role in the immune response to viral infection |
| Assay used | NA |
| PMID | 23985302 |
| Year of Publication | 2013 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1133 |
| Ligand Name | Resiquimod (R-848) |
| Source | imidazoquinoline (others) |
| Sequence of ligand | CCOCC1=NC2=C(N1CC(C)(C)O)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | immune-response modifier possessing antiviral and antitumor activityand also induces the differentiation of MDSCs into mature myeloid cells |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | monocyte/macrophages, plasmacytoid DCs and B-lymphocytes |
| Domain | Cell Compartment/Intracellular (Endosome) |
| Sequence of Receptor | P58681.fasta |
| Swiss prot ID | P58681 |
| Length Of Receptor | 1050 |
| Function | important role in the immune response to viral infection |
| Assay used | NA |
| PMID | 23985302 |
| Year of Publication | 2013 |
| Pubchem assay | Pubchem_assay |