| Primary information |
|---|
| PRRID | PRRID_1130 |
| Ligand Name | muramyl dipeptide (MDP) |
| Source | Gram-positive and negative bacteria |
| Sequence of ligand | CC(C(=O)NC(CCC(=O)O)C(=O)N)NC(=O)C(C)OC1C(C(OC(C1O)CO)O)NC(=O)C |
| Length | NA |
| Type | Peptide |
| Occurence | Natural |
| Role of Ligand | a component of bacterial peptidoglycan, and induces NF-jB activation, leading to enhanced Th1 responses |
| Name of receptor | Nod-like receptor protein 3 (P2X7R) (NLRP3 (P2X7R) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | graft-versus-host disease (GVHD) |
| Domain | NA |
| Sequence of Receptor | Q96P20.fasta |
| Swiss prot ID | Q96P20 |
| Length Of Receptor | 1036 |
| Function | NOD2 functions as a primary sensor of microbial products inducing inflammatory T-cell responses and also negatively regulates TLR-mediated responses |
| Assay used | NA |
| PMID | 23985302 |
| Year of Publication | 2013 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1130 |
| Ligand Name | muramyl dipeptide (MDP) |
| Source | Gram-positive and negative bacteria |
| Sequence of ligand | CC(C(=O)NC(CCC(=O)O)C(=O)N)NC(=O)C(C)OC1C(C(OC(C1O)CO)O)NC(=O)C |
| Length | NA |
| Type | Peptide |
| Occurence | Natural |
| Role of Ligand | a component of bacterial peptidoglycan, and induces NF-jB activation, leading to enhanced Th1 responses |
| Name of receptor | Nod-like receptor protein 3 (P2X7R) (NLRP3 (P2X7R) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | graft-versus-host disease (GVHD) |
| Domain | NA |
| Sequence of Receptor | Q96P20.fasta |
| Swiss prot ID | Q96P20 |
| Length Of Receptor | 1036 |
| Function | NOD2 functions as a primary sensor of microbial products inducing inflammatory T-cell responses and also negatively regulates TLR-mediated responses |
| Assay used | NA |
| PMID | 23985302 |
| Year of Publication | 2013 |
| Pubchem assay | Pubchem_assay |