| Primary information |
|---|
| PRRID | PRRID_1121 |
| Ligand Name | Poly-g-glutamic acid (g-PGA) |
| Source | Bacillus subtilis(Bacteria) |
| Sequence of ligand | C(CC(C(=O)O)NC(=O)CCC(C(=O)O)NC(=O)CCC(C(=O)O)NC(=O)CCC(C(=O)O)N)C=O |
| Length | NA |
| Type | anionic polypeptide |
| Occurence | Natural |
| Role of Ligand | activate immune cells through interactions with toll-like receptor 4 (TLR4). It is able to activate the subsequent signals through TLR4/MD2 to result in dimerization of IRF-3 |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | human peripheral blood mononuclear cells (hPBMCs) |
| Domain | NA |
| Sequence of Receptor | O00206.fasta |
| Swiss prot ID | O00206 |
| Length Of Receptor | 839 |
| Function | TLR 4 leads to an intracellular signaling pathway NF-κB and inflammatory cytokine production which is responsible for activating the innate immune system |
| Assay used | ELISA |
| PMID | 24016850 |
| Year of Publication | 2013 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1121 |
| Ligand Name | Poly-g-glutamic acid (g-PGA) |
| Source | Bacillus subtilis(Bacteria) |
| Sequence of ligand | C(CC(C(=O)O)NC(=O)CCC(C(=O)O)NC(=O)CCC(C(=O)O)NC(=O)CCC(C(=O)O)N)C=O |
| Length | NA |
| Type | anionic polypeptide |
| Occurence | Natural |
| Role of Ligand | activate immune cells through interactions with toll-like receptor 4 (TLR4). It is able to activate the subsequent signals through TLR4/MD2 to result in dimerization of IRF-3 |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | human peripheral blood mononuclear cells (hPBMCs) |
| Domain | NA |
| Sequence of Receptor | O00206.fasta |
| Swiss prot ID | O00206 |
| Length Of Receptor | 839 |
| Function | TLR 4 leads to an intracellular signaling pathway NF-κB and inflammatory cytokine production which is responsible for activating the innate immune system |
| Assay used | ELISA |
| PMID | 24016850 |
| Year of Publication | 2013 |
| Pubchem assay | Pubchem_assay |