| Primary information |
|---|
| PRRID | PRRID_1117 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Staphylococcus staphylolyticus (Bacteria) |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | PcLec5 |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | red
swamp crayfish (Procambarus clarkii) |
| Localization | hepatopancreas, gills and intestine |
| Domain | carbohydrate recognition domain (CRD) |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | play important roles in the innate immune system of crustaceans |
| Assay used | ELISA |
| PMID | 23989040 |
| Year of Publication | 2013 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_1117 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Staphylococcus staphylolyticus (Bacteria) |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | PcLec5 |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | red
swamp crayfish (Procambarus clarkii) |
| Localization | hepatopancreas, gills and intestine |
| Domain | carbohydrate recognition domain (CRD) |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | play important roles in the innate immune system of crustaceans |
| Assay used | ELISA |
| PMID | 23989040 |
| Year of Publication | 2013 |
| Pubchem assay | NA |