| Primary information |
|---|
| PRRID | PRRID_1115 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | TRIF mutant (C57BL/6J-Ticam1Lps2) mice |
| Localization | bone marrow-derived macrophage (BMDM) culture |
| Domain | Toll/IL-1R (TIR) domain |
| Sequence of Receptor | Q9QUN7.fasta |
| Swiss prot ID | Q9QUN7 |
| Length Of Receptor | 784 |
| Function | significant role in the pathogenesis of severe inflammatory responses |
| Assay used | Quantitative Real Time PCR, Cell Viability Assays, Immunoblot and Immunoprecipitations |
| PMID | 24019532 |
| Year of Publication | 2013 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1115 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | TRIF mutant (C57BL/6J-Ticam1Lps2) mice |
| Localization | bone marrow-derived macrophage (BMDM) culture |
| Domain | Toll/IL-1R (TIR) domain |
| Sequence of Receptor | Q9QUN7.fasta |
| Swiss prot ID | Q9QUN7 |
| Length Of Receptor | 784 |
| Function | significant role in the pathogenesis of severe inflammatory responses |
| Assay used | Quantitative Real Time PCR, Cell Viability Assays, Immunoblot and Immunoprecipitations |
| PMID | 24019532 |
| Year of Publication | 2013 |
| Pubchem assay | Pubchem_assay |