| Primary information |
|---|
| PRRID | PRRID_1103 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | Streptococcus pyogenes (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | PPL is a glycoprotein with a lipoteichoic acid binding specificity and elicits the downstream cascade. |
| Name of receptor | Philyra pisum lectin (PPL) |
| Type of receptor | Mannose receptor (MR) |
| Source | Philyra pisum |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It has antiproliferative effects on human cancer cells |
| Assay used | Hemagglutination inhibition assay |
| PMID | 24381505 |
| Year of Publication | 2013 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_1103 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | Streptococcus pyogenes (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | PPL is a glycoprotein with a lipoteichoic acid binding specificity and elicits the downstream cascade. |
| Name of receptor | Philyra pisum lectin (PPL) |
| Type of receptor | Mannose receptor (MR) |
| Source | Philyra pisum |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It has antiproliferative effects on human cancer cells |
| Assay used | Hemagglutination inhibition assay |
| PMID | 24381505 |
| Year of Publication | 2013 |
| Pubchem assay | NA |