Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_1064 details |
| Primary information | |
|---|---|
| PRRID | PRRID_1064 |
| Ligand Name | Heparan sulfate |
| Source | NA |
| Sequence of ligand | COC1C(C(C(OC1C(=O)[O-])OC2C(OC(C(C2[O-])NOS(=O)(=O)O)OC)COS(=O)(=O)O)OS(=O)(=O)O)O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | induce the maturation of DCs |
| Name of receptor | Toll-like receptor 5 (TLR5) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | graft-versus-host disease (GVHD) |
| Domain | NA |
| Sequence of Receptor | O60602.fasta |
| Swiss prot ID | O60602 |
| Length Of Receptor | 858 |
| Function | Serum heparan sulfate levels were associated with GVHD |
| Assay used | NA |
| PMID | 23985302 |
| Year of Publication | 2013 |
| Pubchem assay | Pubchem_assay |
| Primary information | |
|---|---|
| PRRID | PRRID_1064 |
| Ligand Name | Heparan sulfate |
| Source | NA |
| Sequence of ligand | COC1C(C(C(OC1C(=O)[O-])OC2C(OC(C(C2[O-])NOS(=O)(=O)O)OC)COS(=O)(=O)O)OS(=O)(=O)O)O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | induce the maturation of DCs |
| Name of receptor | Toll-like receptor 5 (TLR5) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | graft-versus-host disease (GVHD) |
| Domain | NA |
| Sequence of Receptor | O60602.fasta |
| Swiss prot ID | O60602 |
| Length Of Receptor | 858 |
| Function | Serum heparan sulfate levels were associated with GVHD |
| Assay used | NA |
| PMID | 23985302 |
| Year of Publication | 2013 |
| Pubchem assay | Pubchem_assay |