| Primary information |
|---|
| PRRID | PRRID_1037 |
| Ligand Name | EfLTA |
| Source | Enterococcus faecalis (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | LTA contributes to the inflammatory responses and to the production of chemokines through TLR2 signaling |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | C57BL/6 mice |
| Localization | Macrophages |
| Domain | NA |
| Sequence of Receptor | Q9QUN7.fasta |
| Swiss prot ID | Q9QUN7 |
| Length Of Receptor | 784 |
| Function | triggers the MyD88-dependent signaling pathway, leading to NF-kB activation |
| Assay used | ELISA, RT-PCR, Flow cytometric analysis |
| PMID | 23964117 |
| Year of Publication | 2013 |
| Pubchem assay | Pubchem_assay |
| Primary information |
|---|
| PRRID | PRRID_1037 |
| Ligand Name | EfLTA |
| Source | Enterococcus faecalis (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | LTA contributes to the inflammatory responses and to the production of chemokines through TLR2 signaling |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | C57BL/6 mice |
| Localization | Macrophages |
| Domain | NA |
| Sequence of Receptor | Q9QUN7.fasta |
| Swiss prot ID | Q9QUN7 |
| Length Of Receptor | 784 |
| Function | triggers the MyD88-dependent signaling pathway, leading to NF-kB activation |
| Assay used | ELISA, RT-PCR, Flow cytometric analysis |
| PMID | 23964117 |
| Year of Publication | 2013 |
| Pubchem assay | Pubchem_assay |