| Primary information |
|---|
| PRRID | PRRID_1023 |
| Ligand Name | b-1,3-glucans. |
| Source | Bacteria and fungi |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | NA |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | PibGRP |
| Type of receptor | Gastrin-releasing peptide receptor (GRP) |
| Source | Plodia interpunctella |
| Localization | hemolymph |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | activation of the proPO pathway |
| Assay used | Curdlan Pull-down Assay |
| PMID | 23237493 |
| Year of Publication | 2013 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_1023 |
| Ligand Name | b-1,3-glucans. |
| Source | Bacteria and fungi |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | NA |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | PibGRP |
| Type of receptor | Gastrin-releasing peptide receptor (GRP) |
| Source | Plodia interpunctella |
| Localization | hemolymph |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | activation of the proPO pathway |
| Assay used | Curdlan Pull-down Assay |
| PMID | 23237493 |
| Year of Publication | 2013 |
| Pubchem assay | NA |