| Primary information |
|---|
| PRRID | PRRID_1021 |
| Ligand Name | ATP |
| Source | NA |
| Sequence of ligand | C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | triggers immune responses |
| Name of receptor | Nod-like receptor protein 3 (P2X7R) (NLRP3 (P2X7R) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice |
| Localization | graft-versus-host disease (GVHD) |
| Domain | NA |
| Sequence of Receptor | Q8BHB0.fasta |
| Swiss prot ID | Q8BHB0 |
| Length Of Receptor | 953 |
| Function | Blockade of ATP-P2X7R signaling pathways decreased acute GVHD |
| Assay used | NA |
| PMID | 23985302 |
| Year of Publication | 2013 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_1021 |
| Ligand Name | ATP |
| Source | NA |
| Sequence of ligand | C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | triggers immune responses |
| Name of receptor | Nod-like receptor protein 3 (P2X7R) (NLRP3 (P2X7R) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice |
| Localization | graft-versus-host disease (GVHD) |
| Domain | NA |
| Sequence of Receptor | Q8BHB0.fasta |
| Swiss prot ID | Q8BHB0 |
| Length Of Receptor | 953 |
| Function | Blockade of ATP-P2X7R signaling pathways decreased acute GVHD |
| Assay used | NA |
| PMID | 23985302 |
| Year of Publication | 2013 |
| Pubchem assay | Pubchem Assay |