| Primary information |
|---|
| PRRID | PRRID_1020 |
| Ligand Name | 1,3 beta glucan |
| Source | S. cerevisiae (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | HEK293 cells |
| Domain | NA |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | triggers the MyD88-dependent signaling pathway, leading to NF-kB activation |
| Assay used | NF- |
| PMID | 24098508 |
| Year of Publication | 2013 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_1020 |
| Ligand Name | 1,3 beta glucan |
| Source | S. cerevisiae (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | HEK293 cells |
| Domain | NA |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | triggers the MyD88-dependent signaling pathway, leading to NF-kB activation |
| Assay used | NF- |
| PMID | 24098508 |
| Year of Publication | 2013 |
| Pubchem assay | Pubchem Assay |