| Primary information |
|---|
| PRRID | PRRID_1012 |
| Ligand Name | Resquimod |
| Source | 3M Pharma (others) |
| Sequence of ligand | CCOCC1=NC2=C(N1CC(C)(C)O)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | imidazoquinolines |
| Occurence | Synthetic |
| Role of Ligand | Immunostimulant |
| Name of receptor | Toll-like receptor 7/8 (TLR7/8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Recognition of extracellular PAMPs
Activation leads to pro-inflammatory cytokines and type I IFNs production
Set the pace for an adaptive immune response via T and B cells. |
| Assay used | NA |
| PMID | 23017246 |
| Year of Publication | 2012 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_1012 |
| Ligand Name | Resquimod |
| Source | 3M Pharma (others) |
| Sequence of ligand | CCOCC1=NC2=C(N1CC(C)(C)O)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | imidazoquinolines |
| Occurence | Synthetic |
| Role of Ligand | Immunostimulant |
| Name of receptor | Toll-like receptor 7/8 (TLR7/8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Recognition of extracellular PAMPs
Activation leads to pro-inflammatory cytokines and type I IFNs production
Set the pace for an adaptive immune response via T and B cells. |
| Assay used | NA |
| PMID | 23017246 |
| Year of Publication | 2012 |
| Pubchem assay | NA |