| Primary information |
|---|
| PRRID | PRRID_0977 |
| Ligand Name | ATP |
| Source | NA |
| Sequence of ligand | C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O |
| Length | NA |
| Type | Small molecule |
| Occurence | Natural |
| Role of Ligand | immunostimulant |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 2 (Nod2) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | PBMCs |
| Domain | NA |
| Sequence of Receptor | Q9HC29.fasta |
| Swiss prot ID | Q9HC29 |
| Length Of Receptor | 1040 |
| Function | induction of IL-6 and IL-8 |
| Assay used | ELISA |
| PMID | 22998942 |
| Year of Publication | 2012 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0977 |
| Ligand Name | ATP |
| Source | NA |
| Sequence of ligand | C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O |
| Length | NA |
| Type | Small molecule |
| Occurence | Natural |
| Role of Ligand | immunostimulant |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 2 (Nod2) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | PBMCs |
| Domain | NA |
| Sequence of Receptor | Q9HC29.fasta |
| Swiss prot ID | Q9HC29 |
| Length Of Receptor | 1040 |
| Function | induction of IL-6 and IL-8 |
| Assay used | ELISA |
| PMID | 22998942 |
| Year of Publication | 2012 |
| Pubchem assay | Pubchem Assay |