| Primary information |
|---|
| PRRID | PRRID_0946 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Myeloid cells, T cells, microglia, astrocytes, oligodendrocytes,
neurons |
| Domain | NA |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | significant role in the pathogenesis of severe inflammatory responses |
| Assay used | NA |
| PMID | 21982558 |
| Year of Publication | 2011 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0946 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Myeloid cells, T cells, microglia, astrocytes, oligodendrocytes,
neurons |
| Domain | NA |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | significant role in the pathogenesis of severe inflammatory responses |
| Assay used | NA |
| PMID | 21982558 |
| Year of Publication | 2011 |
| Pubchem assay | Pubchem Assay |