| Primary information |
|---|
| PRRID | PRRID_0939 |
| Ligand Name | Paclitaxel |
| Source | Pacific yew (plant) |
| Sequence of ligand | C1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)C6=CC=CC=C6)O)O)OC(=O)C7=CC=CC=C7)(CO4)OC(=O)C)O)C)OC(=O)C |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | used to treat a number of types of cancer |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 2 (Nod2) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | Myeloid cells, microglia, astrocytes, neurons |
| Domain | NA |
| Sequence of Receptor | Q9HC29.fasta |
| Swiss prot ID | Q9HC29 |
| Length Of Receptor | 1040 |
| Function | TLR 4 leads to an intracellular signaling pathway NF-κB and inflammatory cytokine production which is responsible for activating the innate immune system |
| Assay used | NA |
| PMID | 21982558 |
| Year of Publication | 2011 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0939 |
| Ligand Name | Paclitaxel |
| Source | Pacific yew (plant) |
| Sequence of ligand | C1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)C6=CC=CC=C6)O)O)OC(=O)C7=CC=CC=C7)(CO4)OC(=O)C)O)C)OC(=O)C |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | used to treat a number of types of cancer |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 2 (Nod2) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | Myeloid cells, microglia, astrocytes, neurons |
| Domain | NA |
| Sequence of Receptor | Q9HC29.fasta |
| Swiss prot ID | Q9HC29 |
| Length Of Receptor | 1040 |
| Function | TLR 4 leads to an intracellular signaling pathway NF-κB and inflammatory cytokine production which is responsible for activating the innate immune system |
| Assay used | NA |
| PMID | 21982558 |
| Year of Publication | 2011 |
| Pubchem assay | Pubchem Assay |