| Primary information |
|---|
| PRRID | PRRID_0938 |
| Ligand Name | Oligosaccharides of hyaluronic acid (HA) |
| Source | Endogenous (others) |
| Sequence of ligand | CC(=O)NC1CC(C(OC1OC2C(C(C(OC2C(=O)[O-])O)O)O)CO)O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | the activation of TLR4 by hyaluronic acid leads to a different pattern of gene induction |
| Name of receptor | MDA5 |
| Type of receptor | Rig-like receptor (RLR) |
| Source | Human |
| Localization | Myeloid cells, microglia, astrocytes, neurons |
| Domain | NA |
| Sequence of Receptor | Q53TB6.fasta |
| Swiss prot ID | Q53TB6 |
| Length Of Receptor | 435 |
| Function | plays a fundamental role in pathogen recognition and activation of innate immunity |
| Assay used | NA |
| PMID | 21982558 |
| Year of Publication | 2011 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0938 |
| Ligand Name | Oligosaccharides of hyaluronic acid (HA) |
| Source | Endogenous (others) |
| Sequence of ligand | CC(=O)NC1CC(C(OC1OC2C(C(C(OC2C(=O)[O-])O)O)O)CO)O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | the activation of TLR4 by hyaluronic acid leads to a different pattern of gene induction |
| Name of receptor | MDA5 |
| Type of receptor | Rig-like receptor (RLR) |
| Source | Human |
| Localization | Myeloid cells, microglia, astrocytes, neurons |
| Domain | NA |
| Sequence of Receptor | Q53TB6.fasta |
| Swiss prot ID | Q53TB6 |
| Length Of Receptor | 435 |
| Function | plays a fundamental role in pathogen recognition and activation of innate immunity |
| Assay used | NA |
| PMID | 21982558 |
| Year of Publication | 2011 |
| Pubchem assay | Pubchem Assay |