Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_0935 details |
| Primary information | |
|---|---|
| PRRID | PRRID_0935 |
| Ligand Name | MDP (muramyldipeptide) |
| Source | Gram-negative and Gram-positive bacteria |
| Sequence of ligand | CC(C(=O)NC(CCC(=O)O)C(=O)N)NC(=O)C(C)OC1C(C(OC(C1O)CO)O)NC(=O)C |
| Length | NA |
| Type | Peptide |
| Occurence | Natural |
| Role of Ligand | leads to cytokine activation, especially IL-1α and IL-1β. |
| Name of receptor | Nucleotide-binding oligomerization domain, Leucine rich Repeat and Pyrin domain containing3 (Nalp3) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | Eosinophils |
| Domain | NA |
| Sequence of Receptor | Q96P20.fasta |
| Swiss prot ID | Q96P20 |
| Length Of Receptor | 1036 |
| Function | recognizes fragments of the bacterial cell wall |
| Assay used | real-time reverse transcription-PCR, FACS, ELISA |
| PMID | 21978001 |
| Year of Publication | 2011 |
| Pubchem assay | Pubchem Assay |
| Primary information | |
|---|---|
| PRRID | PRRID_0935 |
| Ligand Name | MDP (muramyldipeptide) |
| Source | Gram-negative and Gram-positive bacteria |
| Sequence of ligand | CC(C(=O)NC(CCC(=O)O)C(=O)N)NC(=O)C(C)OC1C(C(OC(C1O)CO)O)NC(=O)C |
| Length | NA |
| Type | Peptide |
| Occurence | Natural |
| Role of Ligand | leads to cytokine activation, especially IL-1α and IL-1β. |
| Name of receptor | Nucleotide-binding oligomerization domain, Leucine rich Repeat and Pyrin domain containing3 (Nalp3) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | Eosinophils |
| Domain | NA |
| Sequence of Receptor | Q96P20.fasta |
| Swiss prot ID | Q96P20 |
| Length Of Receptor | 1036 |
| Function | recognizes fragments of the bacterial cell wall |
| Assay used | real-time reverse transcription-PCR, FACS, ELISA |
| PMID | 21978001 |
| Year of Publication | 2011 |
| Pubchem assay | Pubchem Assay |