| Primary information |
|---|
| PRRID | PRRID_0932 |
| Ligand Name | Loxoribine (7-allyl-7,8-dihydro-8-oxo-guanosine) |
| Source | Guanosine (others) |
| Sequence of ligand | C=CCN1C2=C(NC(=NC2=O)N)N(C1=O)C3C(C(C(O3)CO)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | up-regulate B-cells lymphoma-2 (Bcl-2) and promote the survival of lung cancer cells |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | B cells, dendritic cells, microglia, astrocytes |
| Domain | NA |
| Sequence of Receptor | Q9NYK1.fasta |
| Swiss prot ID | Q9NYK1 |
| Length Of Receptor | 1049 |
| Function | TLR7-mediated activation of these cells resulted in the induction of the pro-inflammatory cytokines IFN-α, IFN-β, TNF-α, and IL-13 |
| Assay used | NA |
| PMID | 21982558 |
| Year of Publication | 2011 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0932 |
| Ligand Name | Loxoribine (7-allyl-7,8-dihydro-8-oxo-guanosine) |
| Source | Guanosine (others) |
| Sequence of ligand | C=CCN1C2=C(NC(=NC2=O)N)N(C1=O)C3C(C(C(O3)CO)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | up-regulate B-cells lymphoma-2 (Bcl-2) and promote the survival of lung cancer cells |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | B cells, dendritic cells, microglia, astrocytes |
| Domain | NA |
| Sequence of Receptor | Q9NYK1.fasta |
| Swiss prot ID | Q9NYK1 |
| Length Of Receptor | 1049 |
| Function | TLR7-mediated activation of these cells resulted in the induction of the pro-inflammatory cytokines IFN-α, IFN-β, TNF-α, and IL-13 |
| Assay used | NA |
| PMID | 21982558 |
| Year of Publication | 2011 |
| Pubchem assay | Pubchem Assay |