| Primary information |
|---|
| PRRID | PRRID_0929 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | Gram-positive bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Toll-like receptor 6 (TLR6) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Myeloid cells, dendritic cells, microglia, astrocytes |
| Domain | NA |
| Sequence of Receptor | Q9Y2C9.fasta |
| Swiss prot ID | Q9Y2C9 |
| Length Of Receptor | 796 |
| Function | significant role in the pathogenesis of severe inflammatory responses |
| Assay used | NA |
| PMID | 21982558 |
| Year of Publication | 2011 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0929 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | Gram-positive bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Toll-like receptor 6 (TLR6) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Myeloid cells, dendritic cells, microglia, astrocytes |
| Domain | NA |
| Sequence of Receptor | Q9Y2C9.fasta |
| Swiss prot ID | Q9Y2C9 |
| Length Of Receptor | 796 |
| Function | significant role in the pathogenesis of severe inflammatory responses |
| Assay used | NA |
| PMID | 21982558 |
| Year of Publication | 2011 |
| Pubchem assay | Pubchem Assay |