| Primary information |
|---|
| PRRID | PRRID_0915 |
| Ligand Name | Imiquimod (R837) |
| Source | NA |
| Sequence of ligand | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Amine analog to guanosine, is an immune response modifier with potent indirect antiviral activity. |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | important role in the immune response to viral infection |
| Assay used | NA |
| PMID | 21949866 |
| Year of Publication | 2011 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0915 |
| Ligand Name | Imiquimod (R837) |
| Source | NA |
| Sequence of ligand | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Amine analog to guanosine, is an immune response modifier with potent indirect antiviral activity. |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | important role in the immune response to viral infection |
| Assay used | NA |
| PMID | 21949866 |
| Year of Publication | 2011 |
| Pubchem assay | NA |