| Primary information |
|---|
| PRRID | PRRID_0913 |
| Ligand Name | Imidazoquinoline |
| Source | A tricyclic aromatic heterocycle formed by fusion of an imidazole ring with the pyridine ring |
| Sequence of ligand | CC1=C(NC(=C(C1=C2C=CC(=C(C2=O)OC)OC)N)C3=NC4=C(C=C3)C(=O)C(=C5C4=NC(N5)(C)C)OC)C(=O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | Imidazoquinolines are being actively being pursued for therapeutic use anti-viral and anti- allergic |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | TLR7-mediated activation of these cells resulted in the induction of the pro-inflammatory cytokines IFN-α, IFN-β, TNF-α, and IL-13 |
| Assay used | NA |
| PMID | 21955443 |
| Year of Publication | 2011 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0913 |
| Ligand Name | Imidazoquinoline |
| Source | A tricyclic aromatic heterocycle formed by fusion of an imidazole ring with the pyridine ring |
| Sequence of ligand | CC1=C(NC(=C(C1=C2C=CC(=C(C2=O)OC)OC)N)C3=NC4=C(C=C3)C(=O)C(=C5C4=NC(N5)(C)C)OC)C(=O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | Imidazoquinolines are being actively being pursued for therapeutic use anti-viral and anti- allergic |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | TLR7-mediated activation of these cells resulted in the induction of the pro-inflammatory cytokines IFN-α, IFN-β, TNF-α, and IL-13 |
| Assay used | NA |
| PMID | 21955443 |
| Year of Publication | 2011 |
| Pubchem assay | NA |