| Primary information |
|---|
| PRRID | PRRID_0911 |
| Ligand Name | iE-DAP (gamma-D-glutamyl-meso diaminopimelic acid) |
| Source | Bacteria |
| Sequence of ligand | N[C@@H](CCC[C@@H](NC(=O)CC[C@@H](N)C(O)=O)C(O)=O)C(O)=O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | peptidoglycan substructures |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | Eosinophils |
| Domain | NA |
| Sequence of Receptor | Q9Y239.fasta |
| Swiss prot ID | Q9Y239 |
| Length Of Receptor | 953 |
| Function | play key roles in regulation of innate immune response. NLRs can cooperate with Toll-like receptors and regulate inflammatory and apoptotic response. |
| Assay used | real-time reverse transcription-PCR, FACS, ELISA |
| PMID | 21978001 |
| Year of Publication | 2011 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0911 |
| Ligand Name | iE-DAP (gamma-D-glutamyl-meso diaminopimelic acid) |
| Source | Bacteria |
| Sequence of ligand | N[C@@H](CCC[C@@H](NC(=O)CC[C@@H](N)C(O)=O)C(O)=O)C(O)=O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | peptidoglycan substructures |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Human |
| Localization | Eosinophils |
| Domain | NA |
| Sequence of Receptor | Q9Y239.fasta |
| Swiss prot ID | Q9Y239 |
| Length Of Receptor | 953 |
| Function | play key roles in regulation of innate immune response. NLRs can cooperate with Toll-like receptors and regulate inflammatory and apoptotic response. |
| Assay used | real-time reverse transcription-PCR, FACS, ELISA |
| PMID | 21978001 |
| Year of Publication | 2011 |
| Pubchem assay | Pubchem Assay |