Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_0873 details |
| Primary information | |
|---|---|
| PRRID | PRRID_0873 |
| Ligand Name | Bropirimine |
| Source | NA |
| Sequence of ligand | C1=CC=C(C=C1)C2=C(C(=O)N=C(N2)N)Br |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | experimental drug with anti-cancer and antiviral properties |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | TLR7-mediated activation of these cells resulted in the induction of the pro-inflammatory cytokines IFN-α, IFN-β, TNF-α, and IL-13 |
| Assay used | NA |
| PMID | 21955443 |
| Year of Publication | 2011 |
| Pubchem assay | NA |
| Primary information | |
|---|---|
| PRRID | PRRID_0873 |
| Ligand Name | Bropirimine |
| Source | NA |
| Sequence of ligand | C1=CC=C(C=C1)C2=C(C(=O)N=C(N2)N)Br |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Synthetic |
| Role of Ligand | experimental drug with anti-cancer and antiviral properties |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | TLR7-mediated activation of these cells resulted in the induction of the pro-inflammatory cytokines IFN-α, IFN-β, TNF-α, and IL-13 |
| Assay used | NA |
| PMID | 21955443 |
| Year of Publication | 2011 |
| Pubchem assay | NA |