| Primary information |
|---|
| PRRID | PRRID_0864 |
| Ligand Name | β- 1,3-glucan |
| Source | Gram-negative bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | DmGNBP1 |
| Type of receptor | Gram-negative Bacteria-binding Protein (GNBPs) |
| Source | Drosophila melanogaster |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | Q9NHB0.fasta |
| Swiss prot ID | Q9NHB0 |
| Length Of Receptor | 494 |
| Function | It induces the proteolytic cascade |
| Assay used | NA |
| PMID | 20699104 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0864 |
| Ligand Name | β- 1,3-glucan |
| Source | Gram-negative bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Pattern-associated molecular patterns (PAMPs) |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | DmGNBP1 |
| Type of receptor | Gram-negative Bacteria-binding Protein (GNBPs) |
| Source | Drosophila melanogaster |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | Q9NHB0.fasta |
| Swiss prot ID | Q9NHB0 |
| Length Of Receptor | 494 |
| Function | It induces the proteolytic cascade |
| Assay used | NA |
| PMID | 20699104 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |