| Primary information |
|---|
| PRRID | PRRID_0862 |
| Ligand Name | β -1,3-glucan |
| Source | Candida albicans(fungi) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | GmCP10 |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | Galleria mellonella |
| Localization | hemolymph |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It has opsonin activity for the phagocytosis of the microorganisms by hemocytes. |
| Assay used | NA |
| PMID | 20519517 |
| Year of Publication | 2010 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0862 |
| Ligand Name | β -1,3-glucan |
| Source | Candida albicans(fungi) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | GmCP10 |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | Galleria mellonella |
| Localization | hemolymph |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It has opsonin activity for the phagocytosis of the microorganisms by hemocytes. |
| Assay used | NA |
| PMID | 20519517 |
| Year of Publication | 2010 |
| Pubchem assay | NA |