| Primary information |
|---|
| PRRID | PRRID_0860 |
| Ligand Name | β -1,3-glucan |
| Source | S. cerevisiae (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | β-glucan binds to the LGBP and induce innate immunity |
| Name of receptor | Lipopolysaccharide and b-1, 3-glucan binding protein (LGBP) |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | Chlamys farreri |
| Localization | Hemocytes, gills and mantle |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It is involved in pathogens recognition and bacterial agglutination. |
| Assay used | NA |
| PMID | 20659562 |
| Year of Publication | 2010 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0860 |
| Ligand Name | β -1,3-glucan |
| Source | S. cerevisiae (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | β-glucan binds to the LGBP and induce innate immunity |
| Name of receptor | Lipopolysaccharide and b-1, 3-glucan binding protein (LGBP) |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | Chlamys farreri |
| Localization | Hemocytes, gills and mantle |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It is involved in pathogens recognition and bacterial agglutination. |
| Assay used | NA |
| PMID | 20659562 |
| Year of Publication | 2010 |
| Pubchem assay | NA |