| Primary information |
|---|
| PRRID | PRRID_0859 |
| Ligand Name | β -1,3-glucan |
| Source | Vibrio harveyi (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Glucan |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | GNBP |
| Type of receptor | Gram-negative Bacteria-binding Protein (GNBPs) |
| Source | Artemia sinica |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Have cytoprotective effect |
| Assay used | NA |
| PMID | 20699104 |
| Year of Publication | 2010 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0859 |
| Ligand Name | β -1,3-glucan |
| Source | Vibrio harveyi (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Glucan |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | GNBP |
| Type of receptor | Gram-negative Bacteria-binding Protein (GNBPs) |
| Source | Artemia sinica |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Have cytoprotective effect |
| Assay used | NA |
| PMID | 20699104 |
| Year of Publication | 2010 |
| Pubchem assay | NA |